C16H29N — CID 88941049
(3E,5Z)-4-(2-cyclopropylethyl)-N-ethyl-2,3-dimethylhepta-3,5-dien-1-amine (PubChem CID 88941049) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is (3E,5Z)-4-(2-cyclopropylethyl)-N-ethyl-2,3-dimethylhepta-3,5-dien-1-amine.
| Compound Name | (3E,5Z)-4-(2-cyclopropylethyl)-N-ethyl-2,3-dimethylhepta-3,5-dien-1-amine |
|---|---|
| PubChem CID | 88941049 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | (3E,5Z)-4-(2-cyclopropylethyl)-N-ethyl-2,3-dimethylhepta-3,5-dien-1-amine |
| SMILES | C/C=C\C(CCC1CC1)=C(/C)C(C)CNCC |
| InChI | InChI=1S/C16H29N/c1-5-7-16(11-10-15-8-9-15)14(4)13(3)12-17-6-2/h5,7,13,15,17H,6,8-12H2,1-4H3/b7-5-,16-14- |
| InChIKey | IVBOTVNIAGGWSM-WIQSEQRJSA-N |
| XLogP | 4.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|