C12H20N2O2 — CID 88941229
N-[(3Z,5E)-5-(acetamidomethyl)hepta-3,5-dienyl]acetamide (PubChem CID 88941229) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is N-[(3Z,5E)-5-(acetamidomethyl)hepta-3,5-dienyl]acetamide.
| Compound Name | N-[(3Z,5E)-5-(acetamidomethyl)hepta-3,5-dienyl]acetamide |
|---|---|
| PubChem CID | 88941229 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | N-[(3Z,5E)-5-(acetamidomethyl)hepta-3,5-dienyl]acetamide |
| SMILES | C/C=C(\C=C/CCNC(C)=O)CNC(C)=O |
| InChI | InChI=1S/C12H20N2O2/c1-4-12(9-14-11(3)16)7-5-6-8-13-10(2)15/h4-5,7H,6,8-9H2,1-3H3,(H,13,15)(H,14,16)/b7-5-,12-4+ |
| InChIKey | KYUBVVDNLPKTMM-NIZDWENVSA-N |
| XLogP | 1.15 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|