C23H37N2O8PS — CID 88941827
N-[4-(diethoxyphosphorylmethyl)-4,5-dihydro-1,3-thiazol-2-yl]-3,5-bis[[(2S)-1-methoxypropan-2-yl]oxy]benzamide (PubChem CID 88941827) has the molecular formula C23H37N2O8PS and a molecular weight of 532.60 g/mol. Its IUPAC name is N-[4-(diethoxyphosphorylmethyl)-4,5-dihydro-1,3-thiazol-2-yl]-3,5-bis[[(2S)-1-methoxypropan-2-yl]oxy]benzamide.
| Compound Name | N-[4-(diethoxyphosphorylmethyl)-4,5-dihydro-1,3-thiazol-2-yl]-3,5-bis[[(2S)-1-methoxypropan-2-yl]oxy]benzamide |
|---|---|
| PubChem CID | 88941827 |
| Molecular Formula | C23H37N2O8PS |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | N-[4-(diethoxyphosphorylmethyl)-4,5-dihydro-1,3-thiazol-2-yl]-3,5-bis[[(2S)-1-methoxypropan-2-yl]oxy]benzamide |
| SMILES | CCOP(=O)(CC1CSC(NC(=O)c2cc(O[C@@H](C)COC)cc(O[C@@H](C)COC)c2)=N1)OCC |
| InChI | InChI=1S/C23H37N2O8PS/c1-7-30-34(27,31-8-2)14-19-15-35-23(24-19)25-22(26)18-9-20(32-16(3)12-28-5)11-21(10-18)33-17(4)13-29-6/h9-11,16-17,19H,7-8,12-15H2,1-6H3,(H,24,25,26)/t16-,17-,19?/m0/s1 |
| InChIKey | PFGQFKSNNMQHHT-YGYNJSFOSA-N |
| XLogP | 3.98 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|