C16H26N2O — CID 88941839
2,6-ditert-butyl-4-(2,2-diaminoethenyl)phenol (PubChem CID 88941839) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-(2,2-diaminoethenyl)phenol.
| Compound Name | 2,6-ditert-butyl-4-(2,2-diaminoethenyl)phenol |
|---|---|
| PubChem CID | 88941839 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 2,6-ditert-butyl-4-(2,2-diaminoethenyl)phenol |
| SMILES | CC(C)(C)c1cc(C=C(N)N)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C16H26N2O/c1-15(2,3)11-7-10(9-13(17)18)8-12(14(11)19)16(4,5)6/h7-9,19H,17-18H2,1-6H3 |
| InChIKey | IDIYQRDCBXGMBE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |