C22H20N2O3 — CID 8894187
(4-cyano-2-methoxyphenyl) (6R)-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate (PubChem CID 8894187) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is (4-cyano-2-methoxyphenyl) (6R)-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate.
| Compound Name | (4-cyano-2-methoxyphenyl) (6R)-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate |
|---|---|
| PubChem CID | 8894187 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | (4-cyano-2-methoxyphenyl) (6R)-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate |
| SMILES | COc1cc(C#N)ccc1OC(=O)c1ccc2[nH]c3c(c2c1)C[C@H](C)CC3 |
| InChI | InChI=1S/C22H20N2O3/c1-13-3-6-18-16(9-13)17-11-15(5-7-19(17)24-18)22(25)27-20-8-4-14(12-23)10-21(20)26-2/h4-5,7-8,10-11,13,24H,3,6,9H2,1-2H3/t13-/m1/s1 |
| InChIKey | KHEVBCCBMZKPCW-CYBMUJFWSA-N |
| XLogP | 4.39 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|