About 2-[(6-chloro-3-pyridinyl)methylsulfinyl]-1-(1-tricyclo[3.3.1.03,7]nonanyl)ethanone
2-[(6-chloro-3-pyridinyl)methylsulfinyl]-1-(1-tricyclo[3.3.1.03,7]nonanyl)ethanone (PubChem CID 88941948) has the molecular formula C17H20ClNO2S
and a molecular weight of 337.87 g/mol. Its IUPAC name is 2-[(6-chloro-3-pyridinyl)methylsulfinyl]-1-(1-tricyclo[3.3.1.03,7]nonanyl)ethanone.
Molecular Properties
| Compound Name | 2-[(6-chloro-3-pyridinyl)methylsulfinyl]-1-(1-tricyclo[3.3.1.03,7]nonanyl)ethanone |
| PubChem CID | 88941948 |
| Molecular Formula | C17H20ClNO2S |
| Molecular Weight | 337.87 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 2-[(6-chloro-3-pyridinyl)methylsulfinyl]-1-(1-tricyclo[3.3.1.03,7]nonanyl)ethanone |
| SMILES | O=C(CS(=O)Cc1ccc(Cl)nc1)C12CC3CC(C1)C(C3)C2 |
| InChI | InChI=1S/C17H20ClNO2S/c18-16-2-1-11(8-19-16)9-22(21)10-15(20)17-5-12-3-13(6-17)14(4-12)7-17/h1-2,8,12-14H,3-7,9-10H2 |
| InChIKey | CAITYMQDGSUUJG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.87 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-[(6-chloro-3-pyridinyl)methylsulfinyl]-1-(1-tricyclo[3.3.1.03,7]nonanyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-chloro-3-pyridinyl)methylsulfinyl]-1-(1-tricyclo[3.3.1.03,7]nonanyl)ethanone?
The IUPAC name of 2-[(6-chloro-3-pyridinyl)methylsulfinyl]-1-(1-tricyclo[3.3.1.03,7]nonanyl)ethanone (CID 88941948) is 2-[(6-chloro-3-pyridinyl)methylsulfinyl]-1-(1-tricyclo[3.3.1.03,7]nonanyl)ethanone.
What is the SMILES notation for 2-[(6-chloro-3-pyridinyl)methylsulfinyl]-1-(1-tricyclo[3.3.1.03,7]nonanyl)ethanone?
The canonical SMILES for 2-[(6-chloro-3-pyridinyl)methylsulfinyl]-1-(1-tricyclo[3.3.1.03,7]nonanyl)ethanone is O=C(CS(=O)Cc1ccc(Cl)nc1)C12CC3CC(C1)C(C3)C2.
What is the InChIKey of 2-[(6-chloro-3-pyridinyl)methylsulfinyl]-1-(1-tricyclo[3.3.1.03,7]nonanyl)ethanone?
The InChIKey is CAITYMQDGSUUJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20ClNO2S/c18-16-2-1-11(8-19-16)9-22(21)10-15(20)17-5-12-3-13(6-17)14(4-12)7-17/h1-2,8,12-14H,3-7,9-10H2.
What are the key properties of 2-[(6-chloro-3-pyridinyl)methylsulfinyl]-1-(1-tricyclo[3.3.1.03,7]nonanyl)ethanone?
2-[(6-chloro-3-pyridinyl)methylsulfinyl]-1-(1-tricyclo[3.3.1.03,7]nonanyl)ethanone has a molecular weight of 337.87 g/mol, XLogP of 3.38, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-chloro-3-pyridinyl)methylsulfinyl]-1-(1-tricyclo[3.3.1.03,7]nonanyl)ethanone is sourced from PubChem (CID 88941948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).