C21H37NO6 — CID 88941991
11-[3-(1-amino-2-oxopropyl)-2-methyloxiran-2-yl]-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxoundecanal (PubChem CID 88941991) has the molecular formula C21H37NO6 and a molecular weight of 399.53 g/mol. Its IUPAC name is 11-[3-(1-amino-2-oxopropyl)-2-methyloxiran-2-yl]-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxoundecanal.
| Compound Name | 11-[3-(1-amino-2-oxopropyl)-2-methyloxiran-2-yl]-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxoundecanal |
|---|---|
| PubChem CID | 88941991 |
| Molecular Formula | C21H37NO6 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | 11-[3-(1-amino-2-oxopropyl)-2-methyloxiran-2-yl]-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxoundecanal |
| SMILES | CC(=O)C(N)C1OC1(C)CCCC(C)C(O)C(C)C(=O)C(C)(C)C(O)CC=O |
| InChI | InChI=1S/C21H37NO6/c1-12(8-7-10-21(6)19(28-21)16(22)14(3)24)17(26)13(2)18(27)20(4,5)15(25)9-11-23/h11-13,15-17,19,25-26H,7-10,22H2,1-6H3 |
| InChIKey | BTKLJPLHBFBWAA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 130.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|