About (Z)-5,5,5-trifluoro-4-(2-methoxyethylamino)pent-3-en-2-one
(Z)-5,5,5-trifluoro-4-(2-methoxyethylamino)pent-3-en-2-one (PubChem CID 88942074) has the molecular formula C8H12F3NO2
and a molecular weight of 211.18 g/mol. Its IUPAC name is (Z)-5,5,5-trifluoro-4-(2-methoxyethylamino)pent-3-en-2-one.
Molecular Properties
| Compound Name | (Z)-5,5,5-trifluoro-4-(2-methoxyethylamino)pent-3-en-2-one |
| PubChem CID | 88942074 |
| Molecular Formula | C8H12F3NO2 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | (Z)-5,5,5-trifluoro-4-(2-methoxyethylamino)pent-3-en-2-one |
| SMILES | COCCN/C(=C\C(C)=O)C(F)(F)F |
| InChI | InChI=1S/C8H12F3NO2/c1-6(13)5-7(8(9,10)11)12-3-4-14-2/h5,12H,3-4H2,1-2H3/b7-5- |
| InChIKey | SHWGTWKTVPQWLV-ALCCZGGFSA-N |
| XLogP | 1.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-5,5,5-trifluoro-4-(2-methoxyethylamino)pent-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-5,5,5-trifluoro-4-(2-methoxyethylamino)pent-3-en-2-one?
The IUPAC name of (Z)-5,5,5-trifluoro-4-(2-methoxyethylamino)pent-3-en-2-one (CID 88942074) is (Z)-5,5,5-trifluoro-4-(2-methoxyethylamino)pent-3-en-2-one.
What is the SMILES notation for (Z)-5,5,5-trifluoro-4-(2-methoxyethylamino)pent-3-en-2-one?
The canonical SMILES for (Z)-5,5,5-trifluoro-4-(2-methoxyethylamino)pent-3-en-2-one is COCCN/C(=C\C(C)=O)C(F)(F)F.
What is the InChIKey of (Z)-5,5,5-trifluoro-4-(2-methoxyethylamino)pent-3-en-2-one?
The InChIKey is SHWGTWKTVPQWLV-ALCCZGGFSA-N. The full InChI is InChI=1S/C8H12F3NO2/c1-6(13)5-7(8(9,10)11)12-3-4-14-2/h5,12H,3-4H2,1-2H3/b7-5-.
What are the key properties of (Z)-5,5,5-trifluoro-4-(2-methoxyethylamino)pent-3-en-2-one?
(Z)-5,5,5-trifluoro-4-(2-methoxyethylamino)pent-3-en-2-one has a molecular weight of 211.18 g/mol, XLogP of 1.26, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-5,5,5-trifluoro-4-(2-methoxyethylamino)pent-3-en-2-one is sourced from PubChem (CID 88942074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).