C18H22F2O9S — CID 88942340
2-[[9-(1-ethylcyclopentyl)oxycarbonyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 88942340) has the molecular formula C18H22F2O9S and a molecular weight of 452.43 g/mol. Its IUPAC name is 2-[[9-(1-ethylcyclopentyl)oxycarbonyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-[[9-(1-ethylcyclopentyl)oxycarbonyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 88942340 |
| Molecular Formula | C18H22F2O9S |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 2-[[9-(1-ethylcyclopentyl)oxycarbonyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | CCC1(OC(=O)C2C3CC4C(OC(=O)C42)C3OC(=O)C(F)(F)S(=O)(=O)O)CCCC1 |
| InChI | InChI=1S/C18H22F2O9S/c1-2-17(5-3-4-6-17)29-15(22)11-9-7-8-10(11)14(21)27-12(8)13(9)28-16(23)18(19,20)30(24,25)26/h8-13H,2-7H2,1H3,(H,24,25,26) |
| InChIKey | VOTMFIZAHZAIKW-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|