About [(2S,5R)-5-[6-(2-methoxyphenyl)purin-9-yl]oxolan-2-yl]methyl sulfamate
[(2S,5R)-5-[6-(2-methoxyphenyl)purin-9-yl]oxolan-2-yl]methyl sulfamate (PubChem CID 88942885) has the molecular formula C17H19N5O5S
and a molecular weight of 405.44 g/mol. Its IUPAC name is [(2S,5R)-5-[6-(2-methoxyphenyl)purin-9-yl]oxolan-2-yl]methyl sulfamate.
Molecular Properties
| Compound Name | [(2S,5R)-5-[6-(2-methoxyphenyl)purin-9-yl]oxolan-2-yl]methyl sulfamate |
| PubChem CID | 88942885 |
| Molecular Formula | C17H19N5O5S |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | [(2S,5R)-5-[6-(2-methoxyphenyl)purin-9-yl]oxolan-2-yl]methyl sulfamate |
| SMILES | COc1ccccc1-c1ncnc2c1ncn2[C@H]1CC[C@@H](COS(N)(=O)=O)O1 |
| InChI | InChI=1S/C17H19N5O5S/c1-25-13-5-3-2-4-12(13)15-16-17(20-9-19-15)22(10-21-16)14-7-6-11(27-14)8-26-28(18,23)24/h2-5,9-11,14H,6-8H2,1H3,(H2,18,23,24)/t11-,14+/m0/s1 |
| InChIKey | NJZBXKBJANYWSD-SMDDNHRTSA-N |
| XLogP | 1.40 |
| TPSA | 131.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze [(2S,5R)-5-[6-(2-methoxyphenyl)purin-9-yl]oxolan-2-yl]methyl sulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,5R)-5-[6-(2-methoxyphenyl)purin-9-yl]oxolan-2-yl]methyl sulfamate?
The IUPAC name of [(2S,5R)-5-[6-(2-methoxyphenyl)purin-9-yl]oxolan-2-yl]methyl sulfamate (CID 88942885) is [(2S,5R)-5-[6-(2-methoxyphenyl)purin-9-yl]oxolan-2-yl]methyl sulfamate.
What is the SMILES notation for [(2S,5R)-5-[6-(2-methoxyphenyl)purin-9-yl]oxolan-2-yl]methyl sulfamate?
The canonical SMILES for [(2S,5R)-5-[6-(2-methoxyphenyl)purin-9-yl]oxolan-2-yl]methyl sulfamate is COc1ccccc1-c1ncnc2c1ncn2[C@H]1CC[C@@H](COS(N)(=O)=O)O1.
What is the InChIKey of [(2S,5R)-5-[6-(2-methoxyphenyl)purin-9-yl]oxolan-2-yl]methyl sulfamate?
The InChIKey is NJZBXKBJANYWSD-SMDDNHRTSA-N. The full InChI is InChI=1S/C17H19N5O5S/c1-25-13-5-3-2-4-12(13)15-16-17(20-9-19-15)22(10-21-16)14-7-6-11(27-14)8-26-28(18,23)24/h2-5,9-11,14H,6-8H2,1H3,(H2,18,23,24)/t11-,14+/m0/s1.
What are the key properties of [(2S,5R)-5-[6-(2-methoxyphenyl)purin-9-yl]oxolan-2-yl]methyl sulfamate?
[(2S,5R)-5-[6-(2-methoxyphenyl)purin-9-yl]oxolan-2-yl]methyl sulfamate has a molecular weight of 405.44 g/mol, XLogP of 1.40, 6 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,5R)-5-[6-(2-methoxyphenyl)purin-9-yl]oxolan-2-yl]methyl sulfamate is sourced from PubChem (CID 88942885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).