C15H14IN3 — CID 88943138
2-cyclohexa-1,5-dien-1-yl-4-cyclohexa-2,4-dien-1-yl-6-iodo-1,3,5-triazine (PubChem CID 88943138) has the molecular formula C15H14IN3 and a molecular weight of 363.20 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-yl-4-cyclohexa-2,4-dien-1-yl-6-iodo-1,3,5-triazine.
| Compound Name | 2-cyclohexa-1,5-dien-1-yl-4-cyclohexa-2,4-dien-1-yl-6-iodo-1,3,5-triazine |
|---|---|
| PubChem CID | 88943138 |
| Molecular Formula | C15H14IN3 |
| Molecular Weight | 363.20 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-yl-4-cyclohexa-2,4-dien-1-yl-6-iodo-1,3,5-triazine |
| SMILES | Ic1nc(C2=CCCC=C2)nc(C2C=CC=CC2)n1 |
| InChI | InChI=1S/C15H14IN3/c16-15-18-13(11-7-3-1-4-8-11)17-14(19-15)12-9-5-2-6-10-12/h1,3-5,7,9-11H,2,6,8H2 |
| InChIKey | SYUWZLVCUNVPKS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.20 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|