C23H28ClF2N5O2S — CID 88943200
(2Z,3Z)-2-[amino-[4-[(2-chloro-4,4-difluorospiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-1'-yl)methyl]-5-methyl-3,4-dihydropyrazol-2-yl]methylidene]hexa-3,5-dienamide (PubChem CID 88943200) has the molecular formula C23H28ClF2N5O2S and a molecular weight of 512.03 g/mol. Its IUPAC name is (2Z,3Z)-2-[amino-[4-[(2-chloro-4,4-difluorospiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-1'-yl)methyl]-5-methyl-3,4-dihydropyrazol-2-yl]methylidene]hexa-3,5-dienamide.
| Compound Name | (2Z,3Z)-2-[amino-[4-[(2-chloro-4,4-difluorospiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-1'-yl)methyl]-5-methyl-3,4-dihydropyrazol-2-yl]methylidene]hexa-3,5-dienamide |
|---|---|
| PubChem CID | 88943200 |
| Molecular Formula | C23H28ClF2N5O2S |
| Molecular Weight | 512.03 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | (2Z,3Z)-2-[amino-[4-[(2-chloro-4,4-difluorospiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-1'-yl)methyl]-5-methyl-3,4-dihydropyrazol-2-yl]methylidene]hexa-3,5-dienamide |
| SMILES | C=C/C=C\C(C(N)=O)=C(/N)N1CC(CN2CCC3(CC2)OCC(F)(F)c2cc(Cl)sc23)C(C)=N1 |
| InChI | InChI=1S/C23H28ClF2N5O2S/c1-3-4-5-16(21(28)32)20(27)31-12-15(14(2)29-31)11-30-8-6-22(7-9-30)19-17(10-18(24)34-19)23(25,26)13-33-22/h3-5,10,15H,1,6-9,11-13,27H2,2H3,(H2,28,32)/b5-4-,20-16- |
| InChIKey | IEHOSZRLEBJFKN-MKMZQZKOSA-N |
| XLogP | 3.52 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.03 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|