C11H18N2 — CID 88943306
(1Z,3E)-3-(azetidin-1-ylmethyl)-5-methylhexa-1,3,5-trien-1-amine (PubChem CID 88943306) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is (1Z,3E)-3-(azetidin-1-ylmethyl)-5-methylhexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3E)-3-(azetidin-1-ylmethyl)-5-methylhexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 88943306 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | (1Z,3E)-3-(azetidin-1-ylmethyl)-5-methylhexa-1,3,5-trien-1-amine |
| SMILES | C=C(C)/C=C(\C=C/N)CN1CCC1 |
| InChI | InChI=1S/C11H18N2/c1-10(2)8-11(4-5-12)9-13-6-3-7-13/h4-5,8H,1,3,6-7,9,12H2,2H3/b5-4-,11-8+ |
| InChIKey | BSIYUFKDITWIQO-LGXSBLIVSA-N |
| XLogP | 1.67 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|