About (4Z)-N,N-dimethyl-3-propan-2-ylidenehepta-4,6-dien-1-amine
(4Z)-N,N-dimethyl-3-propan-2-ylidenehepta-4,6-dien-1-amine (PubChem CID 88943486) has the molecular formula C12H21N
and a molecular weight of 179.31 g/mol. Its IUPAC name is (4Z)-N,N-dimethyl-3-propan-2-ylidenehepta-4,6-dien-1-amine.
Molecular Properties
| Compound Name | (4Z)-N,N-dimethyl-3-propan-2-ylidenehepta-4,6-dien-1-amine |
| PubChem CID | 88943486 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (4Z)-N,N-dimethyl-3-propan-2-ylidenehepta-4,6-dien-1-amine |
| SMILES | C=C/C=C\C(CCN(C)C)=C(C)C |
| InChI | InChI=1S/C12H21N/c1-6-7-8-12(11(2)3)9-10-13(4)5/h6-8H,1,9-10H2,2-5H3/b8-7- |
| InChIKey | QXNLWIRRAASWGM-FPLPWBNLSA-N |
| XLogP | 3.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-N,N-dimethyl-3-propan-2-ylidenehepta-4,6-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-N,N-dimethyl-3-propan-2-ylidenehepta-4,6-dien-1-amine?
The IUPAC name of (4Z)-N,N-dimethyl-3-propan-2-ylidenehepta-4,6-dien-1-amine (CID 88943486) is (4Z)-N,N-dimethyl-3-propan-2-ylidenehepta-4,6-dien-1-amine.
What is the SMILES notation for (4Z)-N,N-dimethyl-3-propan-2-ylidenehepta-4,6-dien-1-amine?
The canonical SMILES for (4Z)-N,N-dimethyl-3-propan-2-ylidenehepta-4,6-dien-1-amine is C=C/C=C\C(CCN(C)C)=C(C)C.
What is the InChIKey of (4Z)-N,N-dimethyl-3-propan-2-ylidenehepta-4,6-dien-1-amine?
The InChIKey is QXNLWIRRAASWGM-FPLPWBNLSA-N. The full InChI is InChI=1S/C12H21N/c1-6-7-8-12(11(2)3)9-10-13(4)5/h6-8H,1,9-10H2,2-5H3/b8-7-.
What are the key properties of (4Z)-N,N-dimethyl-3-propan-2-ylidenehepta-4,6-dien-1-amine?
(4Z)-N,N-dimethyl-3-propan-2-ylidenehepta-4,6-dien-1-amine has a molecular weight of 179.31 g/mol, XLogP of 3.02, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-N,N-dimethyl-3-propan-2-ylidenehepta-4,6-dien-1-amine is sourced from PubChem (CID 88943486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).