C15H24ClN3O2 — CID 88943490
2-chloro-N-(3,3-diethoxypropyl)-5,6,7,8-tetrahydroquinazolin-4-amine (PubChem CID 88943490) has the molecular formula C15H24ClN3O2 and a molecular weight of 313.83 g/mol. Its IUPAC name is 2-chloro-N-(3,3-diethoxypropyl)-5,6,7,8-tetrahydroquinazolin-4-amine.
| Compound Name | 2-chloro-N-(3,3-diethoxypropyl)-5,6,7,8-tetrahydroquinazolin-4-amine |
|---|---|
| PubChem CID | 88943490 |
| Molecular Formula | C15H24ClN3O2 |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 2-chloro-N-(3,3-diethoxypropyl)-5,6,7,8-tetrahydroquinazolin-4-amine |
| SMILES | CCOC(CCNc1nc(Cl)nc2c1CCCC2)OCC |
| InChI | InChI=1S/C15H24ClN3O2/c1-3-20-13(21-4-2)9-10-17-14-11-7-5-6-8-12(11)18-15(16)19-14/h13H,3-10H2,1-2H3,(H,17,18,19) |
| InChIKey | WDWRCMJKOJJLFI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|