C18H23N3OS3 — CID 8894361
[2-[2-(2-methylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl N,N-diethylcarbamodithioate (PubChem CID 8894361) has the molecular formula C18H23N3OS3 and a molecular weight of 393.60 g/mol. Its IUPAC name is [2-[2-(2-methylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl N,N-diethylcarbamodithioate.
| Compound Name | [2-[2-(2-methylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 8894361 |
| Molecular Formula | C18H23N3OS3 |
| Molecular Weight | 393.60 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | [2-[2-(2-methylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCc1csc(CC(=O)Nc2ccccc2C)n1 |
| InChI | InChI=1S/C18H23N3OS3/c1-4-21(5-2)18(23)25-12-14-11-24-17(19-14)10-16(22)20-15-9-7-6-8-13(15)3/h6-9,11H,4-5,10,12H2,1-3H3,(H,20,22) |
| InChIKey | OVASUHUMLNOQRP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.60 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|