About (2R)-2-cyclohexa-1,5-dien-1-yloxypropanal
(2R)-2-cyclohexa-1,5-dien-1-yloxypropanal (PubChem CID 88943880) has the molecular formula C9H12O2
and a molecular weight of 152.19 g/mol. Its IUPAC name is (2R)-2-cyclohexa-1,5-dien-1-yloxypropanal.
Molecular Properties
| Compound Name | (2R)-2-cyclohexa-1,5-dien-1-yloxypropanal |
| PubChem CID | 88943880 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | (2R)-2-cyclohexa-1,5-dien-1-yloxypropanal |
| SMILES | C[C@H](C=O)OC1=CCCC=C1 |
| InChI | InChI=1S/C9H12O2/c1-8(7-10)11-9-5-3-2-4-6-9/h3,5-8H,2,4H2,1H3/t8-/m1/s1 |
| InChIKey | IGGIMMPAELNRSI-MRVPVSSYSA-N |
| XLogP | 1.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-cyclohexa-1,5-dien-1-yloxypropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-cyclohexa-1,5-dien-1-yloxypropanal?
The IUPAC name of (2R)-2-cyclohexa-1,5-dien-1-yloxypropanal (CID 88943880) is (2R)-2-cyclohexa-1,5-dien-1-yloxypropanal.
What is the SMILES notation for (2R)-2-cyclohexa-1,5-dien-1-yloxypropanal?
The canonical SMILES for (2R)-2-cyclohexa-1,5-dien-1-yloxypropanal is C[C@H](C=O)OC1=CCCC=C1.
What is the InChIKey of (2R)-2-cyclohexa-1,5-dien-1-yloxypropanal?
The InChIKey is IGGIMMPAELNRSI-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H12O2/c1-8(7-10)11-9-5-3-2-4-6-9/h3,5-8H,2,4H2,1H3/t8-/m1/s1.
What are the key properties of (2R)-2-cyclohexa-1,5-dien-1-yloxypropanal?
(2R)-2-cyclohexa-1,5-dien-1-yloxypropanal has a molecular weight of 152.19 g/mol, XLogP of 1.82, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-cyclohexa-1,5-dien-1-yloxypropanal is sourced from PubChem (CID 88943880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).