C27H26F5N5O4 — CID 88944089
4-[[5-acetyl-4-[(2,3,4,5,6-pentafluorophenoxy)methyl]pyrimidin-2-yl]amino]-3-methoxy-N-(1-methylpiperidin-4-yl)benzamide (PubChem CID 88944089) has the molecular formula C27H26F5N5O4 and a molecular weight of 579.53 g/mol. Its IUPAC name is 4-[[5-acetyl-4-[(2,3,4,5,6-pentafluorophenoxy)methyl]pyrimidin-2-yl]amino]-3-methoxy-N-(1-methylpiperidin-4-yl)benzamide.
| Compound Name | 4-[[5-acetyl-4-[(2,3,4,5,6-pentafluorophenoxy)methyl]pyrimidin-2-yl]amino]-3-methoxy-N-(1-methylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 88944089 |
| Molecular Formula | C27H26F5N5O4 |
| Molecular Weight | 579.53 g/mol |
| Exact Mass | 579.19 |
| IUPAC Name | 4-[[5-acetyl-4-[(2,3,4,5,6-pentafluorophenoxy)methyl]pyrimidin-2-yl]amino]-3-methoxy-N-(1-methylpiperidin-4-yl)benzamide |
| SMILES | COc1cc(C(=O)NC2CCN(C)CC2)ccc1Nc1ncc(C(C)=O)c(COc2c(F)c(F)c(F)c(F)c2F)n1 |
| InChI | InChI=1S/C27H26F5N5O4/c1-13(38)16-11-33-27(36-18(16)12-41-25-23(31)21(29)20(28)22(30)24(25)32)35-17-5-4-14(10-19(17)40-3)26(39)34-15-6-8-37(2)9-7-15/h4-5,10-11,15H,6-9,12H2,1-3H3,(H,34,39)(H,33,35,36) |
| InChIKey | YISRDDWZSXCTTG-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.53 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|