C6H12N4 — CID 88944339
(1Z)-1-N'-ethenylbuta-1,3-diene-1,1,2,3-tetramine (PubChem CID 88944339) has the molecular formula C6H12N4 and a molecular weight of 140.19 g/mol. Its IUPAC name is (1Z)-1-N'-ethenylbuta-1,3-diene-1,1,2,3-tetramine.
| Compound Name | (1Z)-1-N'-ethenylbuta-1,3-diene-1,1,2,3-tetramine |
|---|---|
| PubChem CID | 88944339 |
| Molecular Formula | C6H12N4 |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.11 |
| IUPAC Name | (1Z)-1-N'-ethenylbuta-1,3-diene-1,1,2,3-tetramine |
| SMILES | C=CN/C(N)=C(\N)C(=C)N |
| InChI | InChI=1S/C6H12N4/c1-3-10-6(9)5(8)4(2)7/h3,10H,1-2,7-9H2/b6-5- |
| InChIKey | VBTSEBKXJDZMBZ-WAYWQWQTSA-N |
| XLogP | -0.72 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|