C16H18O3 — CID 88944462
7a-methyl-1a-(3-methylbut-2-en-2-yl)-2a,6a-dihydronaphtho[2,3-b]oxirene-2,7-dione (PubChem CID 88944462) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 7a-methyl-1a-(3-methylbut-2-en-2-yl)-2a,6a-dihydronaphtho[2,3-b]oxirene-2,7-dione.
| Compound Name | 7a-methyl-1a-(3-methylbut-2-en-2-yl)-2a,6a-dihydronaphtho[2,3-b]oxirene-2,7-dione |
|---|---|
| PubChem CID | 88944462 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 7a-methyl-1a-(3-methylbut-2-en-2-yl)-2a,6a-dihydronaphtho[2,3-b]oxirene-2,7-dione |
| SMILES | CC(C)=C(C)C12OC1(C)C(=O)C1C=CC=CC1C2=O |
| InChI | InChI=1S/C16H18O3/c1-9(2)10(3)16-14(18)12-8-6-5-7-11(12)13(17)15(16,4)19-16/h5-8,11-12H,1-4H3 |
| InChIKey | FSZPSDFLEVAQNW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|