About N,N-dihydroxy-2-methylsulfonylpyrazolo[1,5-a]pyridin-3-amine
N,N-dihydroxy-2-methylsulfonylpyrazolo[1,5-a]pyridin-3-amine (PubChem CID 88944625) has the molecular formula C8H9N3O4S
and a molecular weight of 243.24 g/mol. Its IUPAC name is N,N-dihydroxy-2-methylsulfonylpyrazolo[1,5-a]pyridin-3-amine.
Molecular Properties
| Compound Name | N,N-dihydroxy-2-methylsulfonylpyrazolo[1,5-a]pyridin-3-amine |
| PubChem CID | 88944625 |
| Molecular Formula | C8H9N3O4S |
| Molecular Weight | 243.24 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | N,N-dihydroxy-2-methylsulfonylpyrazolo[1,5-a]pyridin-3-amine |
| SMILES | CS(=O)(=O)c1nn2ccccc2c1N(O)O |
| InChI | InChI=1S/C8H9N3O4S/c1-16(14,15)8-7(11(12)13)6-4-2-3-5-10(6)9-8/h2-5,12-13H,1H3 |
| InChIKey | SEQFQFAIOIDITG-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.24 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-dihydroxy-2-methylsulfonylpyrazolo[1,5-a]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dihydroxy-2-methylsulfonylpyrazolo[1,5-a]pyridin-3-amine?
The IUPAC name of N,N-dihydroxy-2-methylsulfonylpyrazolo[1,5-a]pyridin-3-amine (CID 88944625) is N,N-dihydroxy-2-methylsulfonylpyrazolo[1,5-a]pyridin-3-amine.
What is the SMILES notation for N,N-dihydroxy-2-methylsulfonylpyrazolo[1,5-a]pyridin-3-amine?
The canonical SMILES for N,N-dihydroxy-2-methylsulfonylpyrazolo[1,5-a]pyridin-3-amine is CS(=O)(=O)c1nn2ccccc2c1N(O)O.
What is the InChIKey of N,N-dihydroxy-2-methylsulfonylpyrazolo[1,5-a]pyridin-3-amine?
The InChIKey is SEQFQFAIOIDITG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O4S/c1-16(14,15)8-7(11(12)13)6-4-2-3-5-10(6)9-8/h2-5,12-13H,1H3.
What are the key properties of N,N-dihydroxy-2-methylsulfonylpyrazolo[1,5-a]pyridin-3-amine?
N,N-dihydroxy-2-methylsulfonylpyrazolo[1,5-a]pyridin-3-amine has a molecular weight of 243.24 g/mol, XLogP of 0.32, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dihydroxy-2-methylsulfonylpyrazolo[1,5-a]pyridin-3-amine is sourced from PubChem (CID 88944625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).