About N-[(E)-2-[(3S,5R)-3,5-dimethylpiperazin-1-yl]prop-1-enyl]but-3-en-2-imine
N-[(E)-2-[(3S,5R)-3,5-dimethylpiperazin-1-yl]prop-1-enyl]but-3-en-2-imine (PubChem CID 88944973) has the molecular formula C13H23N3
and a molecular weight of 221.35 g/mol. Its IUPAC name is N-[(E)-2-[(3S,5R)-3,5-dimethylpiperazin-1-yl]prop-1-enyl]but-3-en-2-imine.
Molecular Properties
| Compound Name | N-[(E)-2-[(3S,5R)-3,5-dimethylpiperazin-1-yl]prop-1-enyl]but-3-en-2-imine |
| PubChem CID | 88944973 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | N-[(E)-2-[(3S,5R)-3,5-dimethylpiperazin-1-yl]prop-1-enyl]but-3-en-2-imine |
| SMILES | C=C/C(C)=N/C=C(\C)N1C[C@@H](C)N[C@@H](C)C1 |
| InChI | InChI=1S/C13H23N3/c1-6-10(2)14-7-13(5)16-8-11(3)15-12(4)9-16/h6-7,11-12,15H,1,8-9H2,2-5H3/b13-7+,14-10+/t11-,12+ |
| InChIKey | ARNXFTDGXPKVPK-HXHASGMGSA-N |
| XLogP | 2.18 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-2-[(3S,5R)-3,5-dimethylpiperazin-1-yl]prop-1-enyl]but-3-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-2-[(3S,5R)-3,5-dimethylpiperazin-1-yl]prop-1-enyl]but-3-en-2-imine?
The IUPAC name of N-[(E)-2-[(3S,5R)-3,5-dimethylpiperazin-1-yl]prop-1-enyl]but-3-en-2-imine (CID 88944973) is N-[(E)-2-[(3S,5R)-3,5-dimethylpiperazin-1-yl]prop-1-enyl]but-3-en-2-imine.
What is the SMILES notation for N-[(E)-2-[(3S,5R)-3,5-dimethylpiperazin-1-yl]prop-1-enyl]but-3-en-2-imine?
The canonical SMILES for N-[(E)-2-[(3S,5R)-3,5-dimethylpiperazin-1-yl]prop-1-enyl]but-3-en-2-imine is C=C/C(C)=N/C=C(\C)N1C[C@@H](C)N[C@@H](C)C1.
What is the InChIKey of N-[(E)-2-[(3S,5R)-3,5-dimethylpiperazin-1-yl]prop-1-enyl]but-3-en-2-imine?
The InChIKey is ARNXFTDGXPKVPK-HXHASGMGSA-N. The full InChI is InChI=1S/C13H23N3/c1-6-10(2)14-7-13(5)16-8-11(3)15-12(4)9-16/h6-7,11-12,15H,1,8-9H2,2-5H3/b13-7+,14-10+/t11-,12+.
What are the key properties of N-[(E)-2-[(3S,5R)-3,5-dimethylpiperazin-1-yl]prop-1-enyl]but-3-en-2-imine?
N-[(E)-2-[(3S,5R)-3,5-dimethylpiperazin-1-yl]prop-1-enyl]but-3-en-2-imine has a molecular weight of 221.35 g/mol, XLogP of 2.18, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-2-[(3S,5R)-3,5-dimethylpiperazin-1-yl]prop-1-enyl]but-3-en-2-imine is sourced from PubChem (CID 88944973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).