C13H26N2 — CID 88944990
N-ethyl-N'-[(2E,4Z)-hepta-2,4-dien-2-yl]-N,N'-dimethylethane-1,2-diamine (PubChem CID 88944990) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is N-ethyl-N'-[(2E,4Z)-hepta-2,4-dien-2-yl]-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N-ethyl-N'-[(2E,4Z)-hepta-2,4-dien-2-yl]-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 88944990 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | N-ethyl-N'-[(2E,4Z)-hepta-2,4-dien-2-yl]-N,N'-dimethylethane-1,2-diamine |
| SMILES | CC/C=C\C=C(/C)N(C)CCN(C)CC |
| InChI | InChI=1S/C13H26N2/c1-6-8-9-10-13(3)15(5)12-11-14(4)7-2/h8-10H,6-7,11-12H2,1-5H3/b9-8-,13-10+ |
| InChIKey | WBMXLAMIBRDGKG-JQHRQWORSA-N |
| XLogP | 2.74 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|