C13H19N3 — CID 88945034
(2Z)-N'-[(2Z,4Z,6Z)-5-aminoocta-2,4,6-trien-4-yl]penta-2,4-dienimidamide (PubChem CID 88945034) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is (2Z)-N'-[(2Z,4Z,6Z)-5-aminoocta-2,4,6-trien-4-yl]penta-2,4-dienimidamide.
| Compound Name | (2Z)-N'-[(2Z,4Z,6Z)-5-aminoocta-2,4,6-trien-4-yl]penta-2,4-dienimidamide |
|---|---|
| PubChem CID | 88945034 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | (2Z)-N'-[(2Z,4Z,6Z)-5-aminoocta-2,4,6-trien-4-yl]penta-2,4-dienimidamide |
| SMILES | C=C/C=C\C(N)=N\C(\C=C/C)=C(N)\C=C/C |
| InChI | InChI=1S/C13H19N3/c1-4-7-10-13(15)16-12(9-6-3)11(14)8-5-2/h4-10H,1,14H2,2-3H3,(H2,15,16)/b8-5-,9-6-,10-7-,12-11- |
| InChIKey | IXXBIXZYXMYQJH-DAYRUDSOSA-N |
| XLogP | 2.41 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|