C11H22N2 — CID 88945052
N',N'-dimethyl-N-[(2Z,4Z)-4-methylhexa-2,4-dienyl]ethane-1,2-diamine (PubChem CID 88945052) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is N',N'-dimethyl-N-[(2Z,4Z)-4-methylhexa-2,4-dienyl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-[(2Z,4Z)-4-methylhexa-2,4-dienyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 88945052 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | N',N'-dimethyl-N-[(2Z,4Z)-4-methylhexa-2,4-dienyl]ethane-1,2-diamine |
| SMILES | C/C=C(C)\C=C/CNCCN(C)C |
| InChI | InChI=1S/C11H22N2/c1-5-11(2)7-6-8-12-9-10-13(3)4/h5-7,12H,8-10H2,1-4H3/b7-6-,11-5- |
| InChIKey | UZEKKSAQQMXFSU-PDDHADQFSA-N |
| XLogP | 1.66 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|