C8H16F3NOS — CID 88945212
(1S)-N-butylsulfanyl-1-ethoxy-2,2,2-trifluoroethanamine (PubChem CID 88945212) has the molecular formula C8H16F3NOS and a molecular weight of 231.28 g/mol. Its IUPAC name is (1S)-N-butylsulfanyl-1-ethoxy-2,2,2-trifluoroethanamine.
| Compound Name | (1S)-N-butylsulfanyl-1-ethoxy-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 88945212 |
| Molecular Formula | C8H16F3NOS |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | (1S)-N-butylsulfanyl-1-ethoxy-2,2,2-trifluoroethanamine |
| SMILES | CCCCSN[C@@H](OCC)C(F)(F)F |
| InChI | InChI=1S/C8H16F3NOS/c1-3-5-6-14-12-7(13-4-2)8(9,10)11/h7,12H,3-6H2,1-2H3/t7-/m0/s1 |
| InChIKey | VTQWBZJCMMAMJG-ZETCQYMHSA-N |
| XLogP | 2.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|