C24H31N2O2S2+ — CID 88945408
dithiepan-4-yl 4-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]butanoate (PubChem CID 88945408) has the molecular formula C24H31N2O2S2+ and a molecular weight of 443.66 g/mol. Its IUPAC name is dithiepan-4-yl 4-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]butanoate.
| Compound Name | dithiepan-4-yl 4-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]butanoate |
|---|---|
| PubChem CID | 88945408 |
| Molecular Formula | C24H31N2O2S2+ |
| Molecular Weight | 443.66 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | dithiepan-4-yl 4-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]butanoate |
| SMILES | CN(C)c1ccc(/C=C/c2cccc[n+]2CCCC(=O)OC2CCCSSC2)cc1 |
| InChI | InChI=1S/C24H31N2O2S2/c1-25(2)21-13-10-20(11-14-21)12-15-22-7-3-4-16-26(22)17-5-9-24(27)28-23-8-6-18-29-30-19-23/h3-4,7,10-16,23H,5-6,8-9,17-19H2,1-2H3/q+1 |
| InChIKey | VHKOPXRUDZGVBZ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.66 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|