C28H41N3O3S2 — CID 88945419
N-[3-[[(2E,4E)-5-[4-[bis(2-hydroxyethyl)amino]phenyl]-3-ethenylpenta-2,4-dienylidene]amino]propyl]-5-(dithiolan-3-yl)pentanamide (PubChem CID 88945419) has the molecular formula C28H41N3O3S2 and a molecular weight of 531.79 g/mol. Its IUPAC name is N-[3-[[(2E,4E)-5-[4-[bis(2-hydroxyethyl)amino]phenyl]-3-ethenylpenta-2,4-dienylidene]amino]propyl]-5-(dithiolan-3-yl)pentanamide.
| Compound Name | N-[3-[[(2E,4E)-5-[4-[bis(2-hydroxyethyl)amino]phenyl]-3-ethenylpenta-2,4-dienylidene]amino]propyl]-5-(dithiolan-3-yl)pentanamide |
|---|---|
| PubChem CID | 88945419 |
| Molecular Formula | C28H41N3O3S2 |
| Molecular Weight | 531.79 g/mol |
| Exact Mass | 531.26 |
| IUPAC Name | N-[3-[[(2E,4E)-5-[4-[bis(2-hydroxyethyl)amino]phenyl]-3-ethenylpenta-2,4-dienylidene]amino]propyl]-5-(dithiolan-3-yl)pentanamide |
| SMILES | C=CC(/C=C/c1ccc(N(CCO)CCO)cc1)=C\C=N\CCCNC(=O)CCCCC1CCSS1 |
| InChI | InChI=1S/C28H41N3O3S2/c1-2-24(8-9-25-10-12-26(13-11-25)31(19-21-32)20-22-33)14-18-29-16-5-17-30-28(34)7-4-3-6-27-15-23-35-36-27/h2,8-14,18,27,32-33H,1,3-7,15-17,19-23H2,(H,30,34)/b9-8+,24-14+,29-18+ |
| InChIKey | YGVKGJABAKODFW-KMJWWHGXSA-N |
| XLogP | 4.89 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.79 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|