C13H21I — CID 88945703
(3E,5E,7E)-1-iodo-3,5,7-trimethyldeca-3,5,7-triene (PubChem CID 88945703) has the molecular formula C13H21I and a molecular weight of 304.22 g/mol. Its IUPAC name is (3E,5E,7E)-1-iodo-3,5,7-trimethyldeca-3,5,7-triene.
| Compound Name | (3E,5E,7E)-1-iodo-3,5,7-trimethyldeca-3,5,7-triene |
|---|---|
| PubChem CID | 88945703 |
| Molecular Formula | C13H21I |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | (3E,5E,7E)-1-iodo-3,5,7-trimethyldeca-3,5,7-triene |
| SMILES | CC/C=C(C)/C=C(C)/C=C(\C)CCI |
| InChI | InChI=1S/C13H21I/c1-5-6-11(2)9-13(4)10-12(3)7-8-14/h6,9-10H,5,7-8H2,1-4H3/b11-6+,12-10+,13-9+ |
| InChIKey | GKRJCMUGUFCJPV-GMUYYHJFSA-N |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|