C10H20N4O2 — CID 88945771
1,4,7,10-tetrazacyclododecane-1,7-dicarbaldehyde (PubChem CID 88945771) has the molecular formula C10H20N4O2 and a molecular weight of 228.30 g/mol. Its IUPAC name is 1,4,7,10-tetrazacyclododecane-1,7-dicarbaldehyde.
| Compound Name | 1,4,7,10-tetrazacyclododecane-1,7-dicarbaldehyde |
|---|---|
| PubChem CID | 88945771 |
| Molecular Formula | C10H20N4O2 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 1,4,7,10-tetrazacyclododecane-1,7-dicarbaldehyde |
| SMILES | O=CN1CCNCCN(C=O)CCNCC1 |
| InChI | InChI=1S/C10H20N4O2/c15-9-13-5-1-11-2-6-14(10-16)8-4-12-3-7-13/h9-12H,1-8H2 |
| InChIKey | MABVFQDRBDBNON-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|