C40H32N6O5 — CID 88946123
3-[1-[1-[1-(6-indazol-1-yl-1,3-dioxobenzo[de]isoquinolin-2-yl)ethylamino]propylamino]ethyl]-11-oxa-3-azatetracyclo[7.6.1.05,16.010,14]hexadeca-1(16),5,7,9,12,14-hexaene-2,4-dione (PubChem CID 88946123) has the molecular formula C40H32N6O5 and a molecular weight of 676.73 g/mol. Its IUPAC name is 3-[1-[1-[1-(6-indazol-1-yl-1,3-dioxobenzo[de]isoquinolin-2-yl)ethylamino]propylamino]ethyl]-11-oxa-3-azatetracyclo[7.6.1.05,16.010,14]hexadeca-1(16),5,7,9,12,14-hexaene-2,4-dione.
| Compound Name | 3-[1-[1-[1-(6-indazol-1-yl-1,3-dioxobenzo[de]isoquinolin-2-yl)ethylamino]propylamino]ethyl]-11-oxa-3-azatetracyclo[7.6.1.05,16.010,14]hexadeca-1(16),5,7,9,12,14-hexaene-2,4-dione |
|---|---|
| PubChem CID | 88946123 |
| Molecular Formula | C40H32N6O5 |
| Molecular Weight | 676.73 g/mol |
| Exact Mass | 676.24 |
| IUPAC Name | 3-[1-[1-[1-(6-indazol-1-yl-1,3-dioxobenzo[de]isoquinolin-2-yl)ethylamino]propylamino]ethyl]-11-oxa-3-azatetracyclo[7.6.1.05,16.010,14]hexadeca-1(16),5,7,9,12,14-hexaene-2,4-dione |
| SMILES | CCC(NC(C)N1C(=O)c2cccc3c(-n4ncc5ccccc54)ccc(c23)C1=O)NC(C)N1C(=O)c2cccc3c2c(cc2ccoc23)C1=O |
| InChI | InChI=1S/C40H32N6O5/c1-4-33(43-22(3)45-38(48)28-13-8-11-26-35(28)30(40(45)50)19-23-17-18-51-36(23)26)42-21(2)44-37(47)27-12-7-10-25-32(16-15-29(34(25)27)39(44)49)46-31-14-6-5-9-24(31)20-41-46/h5-22,33,42-43H,4H2,1-3H3 |
| InChIKey | SNRBFUWJEIETEN-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 129.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.73 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|