C23H9F3O8S — CID 88946444
(10-hydroxy-5,7,12,14-tetraoxopentacen-2-yl) trifluoromethanesulfonate (PubChem CID 88946444) has the molecular formula C23H9F3O8S and a molecular weight of 502.38 g/mol. Its IUPAC name is (10-hydroxy-5,7,12,14-tetraoxopentacen-2-yl) trifluoromethanesulfonate.
| Compound Name | (10-hydroxy-5,7,12,14-tetraoxopentacen-2-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 88946444 |
| Molecular Formula | C23H9F3O8S |
| Molecular Weight | 502.38 g/mol |
| Exact Mass | 502.00 |
| IUPAC Name | (10-hydroxy-5,7,12,14-tetraoxopentacen-2-yl) trifluoromethanesulfonate |
| SMILES | O=c1c2ccc(O)cc2c(=O)c2cc3c(=O)c4cc(OS(=O)(=O)C(F)(F)F)ccc4c(=O)c3cc12 |
| InChI | InChI=1S/C23H9F3O8S/c24-23(25,26)35(32,33)34-10-2-4-12-14(6-10)22(31)18-8-17-15(7-16(18)20(12)29)19(28)11-3-1-9(27)5-13(11)21(17)30/h1-8,27H |
| InChIKey | CNAKORMROYBWHK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|