C20H18BN7OS — CID 88946473
CID 88946473 (PubChem CID 88946473) has the molecular formula C20H18BN7OS and a molecular weight of 415.29 g/mol.
| Compound Name | CID 88946473 |
|---|---|
| PubChem CID | 88946473 |
| Molecular Formula | C20H18BN7OS |
| Molecular Weight | 415.29 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | — |
| SMILES | [B]N1CCN(c2ccc(-c3nc4c(C(=O)Nc5nccs5)cccc4[nH]3)cn2)CC1 |
| InChI | InChI=1S/C20H18BN7OS/c21-28-9-7-27(8-10-28)16-5-4-13(12-23-16)18-24-15-3-1-2-14(17(15)25-18)19(29)26-20-22-6-11-30-20/h1-6,11-12H,7-10H2,(H,24,25)(H,22,26,29) |
| InChIKey | IAGFEHRXCMTUSM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|