About 4-hydroxy-2,7-bis(trifluoromethyl)-10H-acridin-9-one
4-hydroxy-2,7-bis(trifluoromethyl)-10H-acridin-9-one (PubChem CID 88946758) has the molecular formula C15H7F6NO2
and a molecular weight of 347.21 g/mol. Its IUPAC name is 4-hydroxy-2,7-bis(trifluoromethyl)-10H-acridin-9-one.
Molecular Properties
| Compound Name | 4-hydroxy-2,7-bis(trifluoromethyl)-10H-acridin-9-one |
| PubChem CID | 88946758 |
| Molecular Formula | C15H7F6NO2 |
| Molecular Weight | 347.21 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 4-hydroxy-2,7-bis(trifluoromethyl)-10H-acridin-9-one |
| SMILES | O=c1c2cc(C(F)(F)F)ccc2[nH]c2c(O)cc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C15H7F6NO2/c16-14(17,18)6-1-2-10-8(3-6)13(24)9-4-7(15(19,20)21)5-11(23)12(9)22-10/h1-5,23H,(H,22,24) |
| InChIKey | XFIYLVMJGBYDIO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.21 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-2,7-bis(trifluoromethyl)-10H-acridin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-2,7-bis(trifluoromethyl)-10H-acridin-9-one?
The IUPAC name of 4-hydroxy-2,7-bis(trifluoromethyl)-10H-acridin-9-one (CID 88946758) is 4-hydroxy-2,7-bis(trifluoromethyl)-10H-acridin-9-one.
What is the SMILES notation for 4-hydroxy-2,7-bis(trifluoromethyl)-10H-acridin-9-one?
The canonical SMILES for 4-hydroxy-2,7-bis(trifluoromethyl)-10H-acridin-9-one is O=c1c2cc(C(F)(F)F)ccc2[nH]c2c(O)cc(C(F)(F)F)cc12.
What is the InChIKey of 4-hydroxy-2,7-bis(trifluoromethyl)-10H-acridin-9-one?
The InChIKey is XFIYLVMJGBYDIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H7F6NO2/c16-14(17,18)6-1-2-10-8(3-6)13(24)9-4-7(15(19,20)21)5-11(23)12(9)22-10/h1-5,23H,(H,22,24).
What are the key properties of 4-hydroxy-2,7-bis(trifluoromethyl)-10H-acridin-9-one?
4-hydroxy-2,7-bis(trifluoromethyl)-10H-acridin-9-one has a molecular weight of 347.21 g/mol, XLogP of 4.42, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-2,7-bis(trifluoromethyl)-10H-acridin-9-one is sourced from PubChem (CID 88946758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).