About ditert-butyl 2-[[bis(trifluoromethylsulfonyl)amino]methyl]-2-methylpropanedioate
ditert-butyl 2-[[bis(trifluoromethylsulfonyl)amino]methyl]-2-methylpropanedioate (PubChem CID 88946792) has the molecular formula C15H23F6NO8S2
and a molecular weight of 523.47 g/mol. Its IUPAC name is ditert-butyl 2-[[bis(trifluoromethylsulfonyl)amino]methyl]-2-methylpropanedioate.
Molecular Properties
| Compound Name | ditert-butyl 2-[[bis(trifluoromethylsulfonyl)amino]methyl]-2-methylpropanedioate |
| PubChem CID | 88946792 |
| Molecular Formula | C15H23F6NO8S2 |
| Molecular Weight | 523.47 g/mol |
| Exact Mass | 523.08 |
| IUPAC Name | ditert-butyl 2-[[bis(trifluoromethylsulfonyl)amino]methyl]-2-methylpropanedioate |
| SMILES | CC(C)(C)OC(=O)C(C)(CN(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H23F6NO8S2/c1-11(2,3)29-9(23)13(7,10(24)30-12(4,5)6)8-22(31(25,26)14(16,17)18)32(27,28)15(19,20)21/h8H2,1-7H3 |
| InChIKey | JQLGHGOUTSCRMB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 124.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 523.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl 2-[[bis(trifluoromethylsulfonyl)amino]methyl]-2-methylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl 2-[[bis(trifluoromethylsulfonyl)amino]methyl]-2-methylpropanedioate?
The IUPAC name of ditert-butyl 2-[[bis(trifluoromethylsulfonyl)amino]methyl]-2-methylpropanedioate (CID 88946792) is ditert-butyl 2-[[bis(trifluoromethylsulfonyl)amino]methyl]-2-methylpropanedioate.
What is the SMILES notation for ditert-butyl 2-[[bis(trifluoromethylsulfonyl)amino]methyl]-2-methylpropanedioate?
The canonical SMILES for ditert-butyl 2-[[bis(trifluoromethylsulfonyl)amino]methyl]-2-methylpropanedioate is CC(C)(C)OC(=O)C(C)(CN(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)C(=O)OC(C)(C)C.
What is the InChIKey of ditert-butyl 2-[[bis(trifluoromethylsulfonyl)amino]methyl]-2-methylpropanedioate?
The InChIKey is JQLGHGOUTSCRMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23F6NO8S2/c1-11(2,3)29-9(23)13(7,10(24)30-12(4,5)6)8-22(31(25,26)14(16,17)18)32(27,28)15(19,20)21/h8H2,1-7H3.
What are the key properties of ditert-butyl 2-[[bis(trifluoromethylsulfonyl)amino]methyl]-2-methylpropanedioate?
ditert-butyl 2-[[bis(trifluoromethylsulfonyl)amino]methyl]-2-methylpropanedioate has a molecular weight of 523.47 g/mol, XLogP of 2.68, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl 2-[[bis(trifluoromethylsulfonyl)amino]methyl]-2-methylpropanedioate is sourced from PubChem (CID 88946792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).