C20H19N3O4 — CID 8894691
[4-[methyl-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]carbamoyl]phenyl] acetate (PubChem CID 8894691) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is [4-[methyl-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]carbamoyl]phenyl] acetate.
| Compound Name | [4-[methyl-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 8894691 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | [4-[methyl-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)N(C)Cc2nc(-c3cccc(C)c3)no2)cc1 |
| InChI | InChI=1S/C20H19N3O4/c1-13-5-4-6-16(11-13)19-21-18(27-22-19)12-23(3)20(25)15-7-9-17(10-8-15)26-14(2)24/h4-11H,12H2,1-3H3 |
| InChIKey | UBLZIRVCBMHFQD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|