C11H15NO — CID 88946976
N-[(1R)-1,2,3,4,7,8-hexahydronaphthalen-1-yl]formamide (PubChem CID 88946976) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is N-[(1R)-1,2,3,4,7,8-hexahydronaphthalen-1-yl]formamide.
| Compound Name | N-[(1R)-1,2,3,4,7,8-hexahydronaphthalen-1-yl]formamide |
|---|---|
| PubChem CID | 88946976 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | N-[(1R)-1,2,3,4,7,8-hexahydronaphthalen-1-yl]formamide |
| SMILES | O=CN[C@@H]1CCCC2=C1CCC=C2 |
| InChI | InChI=1S/C11H15NO/c13-8-12-11-7-3-5-9-4-1-2-6-10(9)11/h1,4,8,11H,2-3,5-7H2,(H,12,13)/t11-/m1/s1 |
| InChIKey | OBFZXWRZZNIHAC-LLVKDONJSA-N |
| XLogP | 1.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|