About CID 88947058
CID 88947058 (PubChem CID 88947058) has the molecular formula C35H23BBrN5
and a molecular weight of 604.32 g/mol.
Molecular Properties
| Compound Name | CID 88947058 |
| PubChem CID | 88947058 |
| Molecular Formula | C35H23BBrN5 |
| Molecular Weight | 604.32 g/mol |
| Exact Mass | 603.12 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(c1)c1cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc3c1n2-c1ncc(Br)cc1C3(C)C |
| InChI | InChI=1S/C35H23BBrN5/c1-35(2)27-16-22(33-40-31(20-9-5-3-6-10-20)39-32(41-33)21-11-7-4-8-12-21)15-26-25-17-23(36)13-14-29(25)42(30(26)27)34-28(35)18-24(37)19-38-34/h3-19H,1-2H3 |
| InChIKey | ZUGRPRFMCHVJAW-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 604.32 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 88947058 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88947058?
The IUPAC name of CID 88947058 (CID 88947058) is not available.
What is the SMILES notation for CID 88947058?
The canonical SMILES for CID 88947058 is [B]c1ccc2c(c1)c1cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc3c1n2-c1ncc(Br)cc1C3(C)C.
What is the InChIKey of CID 88947058?
The InChIKey is ZUGRPRFMCHVJAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H23BBrN5/c1-35(2)27-16-22(33-40-31(20-9-5-3-6-10-20)39-32(41-33)21-11-7-4-8-12-21)15-26-25-17-23(36)13-14-29(25)42(30(26)27)34-28(35)18-24(37)19-38-34/h3-19H,1-2H3.
What are the key properties of CID 88947058?
CID 88947058 has a molecular weight of 604.32 g/mol, XLogP of 7.56, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88947058 is sourced from PubChem (CID 88947058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).