C28H45NO9S — CID 88947506
ditert-butyl (2R,4R)-2-[3-(4-methylphenyl)sulfonyloxypropyl]-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate (PubChem CID 88947506) has the molecular formula C28H45NO9S and a molecular weight of 571.73 g/mol. Its IUPAC name is ditert-butyl (2R,4R)-2-[3-(4-methylphenyl)sulfonyloxypropyl]-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate.
| Compound Name | ditert-butyl (2R,4R)-2-[3-(4-methylphenyl)sulfonyloxypropyl]-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
|---|---|
| PubChem CID | 88947506 |
| Molecular Formula | C28H45NO9S |
| Molecular Weight | 571.73 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | ditert-butyl (2R,4R)-2-[3-(4-methylphenyl)sulfonyloxypropyl]-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
| SMILES | Cc1ccc(S(=O)(=O)OCCC[C@H](C[C@@H](NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C28H45NO9S/c1-19-13-15-21(16-14-19)39(33,34)35-17-11-12-20(23(30)36-26(2,3)4)18-22(24(31)37-27(5,6)7)29-25(32)38-28(8,9)10/h13-16,20,22H,11-12,17-18H2,1-10H3,(H,29,32)/t20-,22-/m1/s1 |
| InChIKey | WYQYXUGEBZQJFX-IFMALSPDSA-N |
| XLogP | 5.06 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.73 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|