C8H9F6NO — CID 88947784
(E)-N,N-bis(2,2,2-trifluoroethyl)but-2-enamide (PubChem CID 88947784) has the molecular formula C8H9F6NO and a molecular weight of 249.15 g/mol. Its IUPAC name is (E)-N,N-bis(2,2,2-trifluoroethyl)but-2-enamide.
| Compound Name | (E)-N,N-bis(2,2,2-trifluoroethyl)but-2-enamide |
|---|---|
| PubChem CID | 88947784 |
| Molecular Formula | C8H9F6NO |
| Molecular Weight | 249.15 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | (E)-N,N-bis(2,2,2-trifluoroethyl)but-2-enamide |
| SMILES | C/C=C/C(=O)N(CC(F)(F)F)CC(F)(F)F |
| InChI | InChI=1S/C8H9F6NO/c1-2-3-6(16)15(4-7(9,10)11)5-8(12,13)14/h2-3H,4-5H2,1H3/b3-2+ |
| InChIKey | RPHCJYMHMQHEPU-NSCUHMNNSA-N |
| XLogP | 2.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.15 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|