C57H33N9 — CID 88948040
2,4,6-tris(2,6-dipyridin-2-ylphenyl)benzene-1,3,5-tricarbonitrile (PubChem CID 88948040) has the molecular formula C57H33N9 and a molecular weight of 843.95 g/mol. Its IUPAC name is 2,4,6-tris(2,6-dipyridin-2-ylphenyl)benzene-1,3,5-tricarbonitrile.
| Compound Name | 2,4,6-tris(2,6-dipyridin-2-ylphenyl)benzene-1,3,5-tricarbonitrile |
|---|---|
| PubChem CID | 88948040 |
| Molecular Formula | C57H33N9 |
| Molecular Weight | 843.95 g/mol |
| Exact Mass | 843.29 |
| IUPAC Name | 2,4,6-tris(2,6-dipyridin-2-ylphenyl)benzene-1,3,5-tricarbonitrile |
| SMILES | N#Cc1c(-c2c(-c3ccccn3)cccc2-c2ccccn2)c(C#N)c(-c2c(-c3ccccn3)cccc2-c2ccccn2)c(C#N)c1-c1c(-c2ccccn2)cccc1-c1ccccn1 |
| InChI | InChI=1S/C57H33N9/c58-34-43-55(52-37(46-22-1-7-28-61-46)16-13-17-38(52)47-23-2-8-29-62-47)44(35-59)57(54-41(50-26-5-11-32-65-50)20-15-21-42(54)51-27-6-12-33-66-51)45(36-60)56(43)53-39(48-24-3-9-30-63-48)18-14-19-40(53)49-25-4-10-31-64-49/h1-33H |
| InChIKey | SFQJKYKXWKQLOZ-UHFFFAOYSA-N |
| XLogP | 12.67 |
| TPSA | 148.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.95 |
| LogP ≤ 5 | 12.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |