C32H33BO2 — CID 88948260
2-(8-cyclohexa-1,5-dien-1-yl-1,2,11,12-tetrahydroperylen-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 88948260) has the molecular formula C32H33BO2 and a molecular weight of 460.43 g/mol. Its IUPAC name is 2-(8-cyclohexa-1,5-dien-1-yl-1,2,11,12-tetrahydroperylen-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(8-cyclohexa-1,5-dien-1-yl-1,2,11,12-tetrahydroperylen-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 88948260 |
| Molecular Formula | C32H33BO2 |
| Molecular Weight | 460.43 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | 2-(8-cyclohexa-1,5-dien-1-yl-1,2,11,12-tetrahydroperylen-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C2=c3cccc4c3c(c3c5c(cc(C6=CCCC=C6)cc54)=CCC3)CC2)OC1(C)C |
| InChI | InChI=1S/C32H33BO2/c1-31(2)32(3,4)35-33(34-31)28-17-16-25-23-13-8-12-21-18-22(20-10-6-5-7-11-20)19-27(29(21)23)24-14-9-15-26(28)30(24)25/h6,9-12,14-15,18-19H,5,7-8,13,16-17H2,1-4H3 |
| InChIKey | NPAMEAXVKYSDEC-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.43 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|