C11H13N — CID 88948300
6-methyl-1,2,3,4-tetrahydrocyclohepta[b]pyridine (PubChem CID 88948300) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is 6-methyl-1,2,3,4-tetrahydrocyclohepta[b]pyridine.
| Compound Name | 6-methyl-1,2,3,4-tetrahydrocyclohepta[b]pyridine |
|---|---|
| PubChem CID | 88948300 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 6-methyl-1,2,3,4-tetrahydrocyclohepta[b]pyridine |
| SMILES | CC1=C=C2CCCNC2=CC=C1 |
| InChI | InChI=1S/C11H13N/c1-9-4-2-6-11-10(8-9)5-3-7-12-11/h2,4,6,12H,3,5,7H2,1H3 |
| InChIKey | BZZCOUBQAGKCFZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |