C25H22F2N4O2S — CID 88948697
1-[3-(2-tert-butyl-4-pyridin-4-yl-1,3-thiazol-5-yl)phenyl]-3-(2,4-difluorophenyl)-1-hydroxyurea (PubChem CID 88948697) has the molecular formula C25H22F2N4O2S and a molecular weight of 480.54 g/mol. Its IUPAC name is 1-[3-(2-tert-butyl-4-pyridin-4-yl-1,3-thiazol-5-yl)phenyl]-3-(2,4-difluorophenyl)-1-hydroxyurea.
| Compound Name | 1-[3-(2-tert-butyl-4-pyridin-4-yl-1,3-thiazol-5-yl)phenyl]-3-(2,4-difluorophenyl)-1-hydroxyurea |
|---|---|
| PubChem CID | 88948697 |
| Molecular Formula | C25H22F2N4O2S |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 1-[3-(2-tert-butyl-4-pyridin-4-yl-1,3-thiazol-5-yl)phenyl]-3-(2,4-difluorophenyl)-1-hydroxyurea |
| SMILES | CC(C)(C)c1nc(-c2ccncc2)c(-c2cccc(N(O)C(=O)Nc3ccc(F)cc3F)c2)s1 |
| InChI | InChI=1S/C25H22F2N4O2S/c1-25(2,3)23-30-21(15-9-11-28-12-10-15)22(34-23)16-5-4-6-18(13-16)31(33)24(32)29-20-8-7-17(26)14-19(20)27/h4-14,33H,1-3H3,(H,29,32) |
| InChIKey | PFNHLMUYKKHXMV-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|