C13H17NO — CID 88949195
2-[(3E)-2,6-dimethylhepta-1,3,5-trien-3-yl]iminobut-3-enal (PubChem CID 88949195) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 2-[(3E)-2,6-dimethylhepta-1,3,5-trien-3-yl]iminobut-3-enal.
| Compound Name | 2-[(3E)-2,6-dimethylhepta-1,3,5-trien-3-yl]iminobut-3-enal |
|---|---|
| PubChem CID | 88949195 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 2-[(3E)-2,6-dimethylhepta-1,3,5-trien-3-yl]iminobut-3-enal |
| SMILES | C=C/C(C=O)=N\C(=C\C=C(C)C)C(=C)C |
| InChI | InChI=1S/C13H17NO/c1-6-12(9-15)14-13(11(4)5)8-7-10(2)3/h6-9H,1,4H2,2-3,5H3/b13-8+,14-12+ |
| InChIKey | QSOORBZLBABGPG-LMLHBTEYSA-N |
| XLogP | 3.24 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|