C21H21FN4O2 — CID 88949260
ethyl 5-[(2R,4S)-2-(3-fluorophenyl)-4-methanimidoylpyrrolidin-1-yl]pyrazolo[1,5-a]pyridine-3-carboxylate (PubChem CID 88949260) has the molecular formula C21H21FN4O2 and a molecular weight of 380.42 g/mol. Its IUPAC name is ethyl 5-[(2R,4S)-2-(3-fluorophenyl)-4-methanimidoylpyrrolidin-1-yl]pyrazolo[1,5-a]pyridine-3-carboxylate.
| Compound Name | ethyl 5-[(2R,4S)-2-(3-fluorophenyl)-4-methanimidoylpyrrolidin-1-yl]pyrazolo[1,5-a]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 88949260 |
| Molecular Formula | C21H21FN4O2 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | ethyl 5-[(2R,4S)-2-(3-fluorophenyl)-4-methanimidoylpyrrolidin-1-yl]pyrazolo[1,5-a]pyridine-3-carboxylate |
| SMILES | [H]/N=C/[C@H]1C[C@H](c2cccc(F)c2)N(c2ccn3ncc(C(=O)OCC)c3c2)C1 |
| InChI | InChI=1S/C21H21FN4O2/c1-2-28-21(27)18-12-24-26-7-6-17(10-20(18)26)25-13-14(11-23)8-19(25)15-4-3-5-16(22)9-15/h3-7,9-12,14,19,23H,2,8,13H2,1H3/b23-11+/t14-,19-/m1/s1 |
| InChIKey | WSEIRAUSABLXDI-KAKVAJJJSA-N |
| XLogP | 3.87 |
| TPSA | 70.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|