C28H31N3O3S — CID 88949818
5-[4-[1,1-dimethyl-3-(1-sulfanylpropyl)benzo[e]indol-2-ylidene]but-2-enylidene]-1-ethyl-3-methyl-1,3-diazinane-2,4,6-trione (PubChem CID 88949818) has the molecular formula C28H31N3O3S and a molecular weight of 489.64 g/mol. Its IUPAC name is 5-[4-[1,1-dimethyl-3-(1-sulfanylpropyl)benzo[e]indol-2-ylidene]but-2-enylidene]-1-ethyl-3-methyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[4-[1,1-dimethyl-3-(1-sulfanylpropyl)benzo[e]indol-2-ylidene]but-2-enylidene]-1-ethyl-3-methyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 88949818 |
| Molecular Formula | C28H31N3O3S |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | 5-[4-[1,1-dimethyl-3-(1-sulfanylpropyl)benzo[e]indol-2-ylidene]but-2-enylidene]-1-ethyl-3-methyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCC(S)N1C(=CC=CC=C2C(=O)N(C)C(=O)N(CC)C2=O)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C28H31N3O3S/c1-6-23(35)31-21-17-16-18-12-8-9-13-19(18)24(21)28(3,4)22(31)15-11-10-14-20-25(32)29(5)27(34)30(7-2)26(20)33/h8-17,23,35H,6-7H2,1-5H3 |
| InChIKey | UQARZGRUUYHGCN-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 60.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|