C12H22O2 — CID 88949902
tert-butyl 3-(1,2,2,3,3,4,4-heptadeuteriocyclobutyl)-2-methylpropanoate (PubChem CID 88949902) has the molecular formula C12H22O2 and a molecular weight of 205.35 g/mol. Its IUPAC name is tert-butyl 3-(1,2,2,3,3,4,4-heptadeuteriocyclobutyl)-2-methylpropanoate.
| Compound Name | tert-butyl 3-(1,2,2,3,3,4,4-heptadeuteriocyclobutyl)-2-methylpropanoate |
|---|---|
| PubChem CID | 88949902 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 205.35 g/mol |
| Exact Mass | 205.21 |
| IUPAC Name | tert-butyl 3-(1,2,2,3,3,4,4-heptadeuteriocyclobutyl)-2-methylpropanoate |
| SMILES | [2H]C1([2H])C([2H])([2H])C([2H])(CC(C)C(=O)OC(C)(C)C)C1([2H])[2H] |
| InChI | InChI=1S/C12H22O2/c1-9(8-10-6-5-7-10)11(13)14-12(2,3)4/h9-10H,5-8H2,1-4H3/i5D2,6D2,7D2,10D |
| InChIKey | QXQOFEHXJAFMAW-SVJNQFIOSA-N |
| XLogP | 3.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |