About (4Z)-3,3-dimethyl-5-methylidene-4-prop-2-enylidenepyrrolidin-2-one
(4Z)-3,3-dimethyl-5-methylidene-4-prop-2-enylidenepyrrolidin-2-one (PubChem CID 88950167) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is (4Z)-3,3-dimethyl-5-methylidene-4-prop-2-enylidenepyrrolidin-2-one.
Molecular Properties
| Compound Name | (4Z)-3,3-dimethyl-5-methylidene-4-prop-2-enylidenepyrrolidin-2-one |
| PubChem CID | 88950167 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | (4Z)-3,3-dimethyl-5-methylidene-4-prop-2-enylidenepyrrolidin-2-one |
| SMILES | C=C/C=C1\C(=C)NC(=O)C1(C)C |
| InChI | InChI=1S/C10H13NO/c1-5-6-8-7(2)11-9(12)10(8,3)4/h5-6H,1-2H2,3-4H3,(H,11,12)/b8-6+ |
| InChIKey | DWZYRZKIQYYVDX-SOFGYWHQSA-N |
| XLogP | 1.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4Z)-3,3-dimethyl-5-methylidene-4-prop-2-enylidenepyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-3,3-dimethyl-5-methylidene-4-prop-2-enylidenepyrrolidin-2-one?
The IUPAC name of (4Z)-3,3-dimethyl-5-methylidene-4-prop-2-enylidenepyrrolidin-2-one (CID 88950167) is (4Z)-3,3-dimethyl-5-methylidene-4-prop-2-enylidenepyrrolidin-2-one.
What is the SMILES notation for (4Z)-3,3-dimethyl-5-methylidene-4-prop-2-enylidenepyrrolidin-2-one?
The canonical SMILES for (4Z)-3,3-dimethyl-5-methylidene-4-prop-2-enylidenepyrrolidin-2-one is C=C/C=C1\C(=C)NC(=O)C1(C)C.
What is the InChIKey of (4Z)-3,3-dimethyl-5-methylidene-4-prop-2-enylidenepyrrolidin-2-one?
The InChIKey is DWZYRZKIQYYVDX-SOFGYWHQSA-N. The full InChI is InChI=1S/C10H13NO/c1-5-6-8-7(2)11-9(12)10(8,3)4/h5-6H,1-2H2,3-4H3,(H,11,12)/b8-6+.
What are the key properties of (4Z)-3,3-dimethyl-5-methylidene-4-prop-2-enylidenepyrrolidin-2-one?
(4Z)-3,3-dimethyl-5-methylidene-4-prop-2-enylidenepyrrolidin-2-one has a molecular weight of 163.22 g/mol, XLogP of 1.77, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-3,3-dimethyl-5-methylidene-4-prop-2-enylidenepyrrolidin-2-one is sourced from PubChem (CID 88950167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).