C20H22O — CID 88950265
4-[(3Z,5Z)-5-methylhepta-3,5-dien-2-yl]-1,2-dihydrodibenzofuran (PubChem CID 88950265) has the molecular formula C20H22O and a molecular weight of 278.40 g/mol. Its IUPAC name is 4-[(3Z,5Z)-5-methylhepta-3,5-dien-2-yl]-1,2-dihydrodibenzofuran.
| Compound Name | 4-[(3Z,5Z)-5-methylhepta-3,5-dien-2-yl]-1,2-dihydrodibenzofuran |
|---|---|
| PubChem CID | 88950265 |
| Molecular Formula | C20H22O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 4-[(3Z,5Z)-5-methylhepta-3,5-dien-2-yl]-1,2-dihydrodibenzofuran |
| SMILES | C/C=C(C)\C=C/C(C)C1=CCCc2c1oc1ccccc21 |
| InChI | InChI=1S/C20H22O/c1-4-14(2)12-13-15(3)16-9-7-10-18-17-8-5-6-11-19(17)21-20(16)18/h4-6,8-9,11-13,15H,7,10H2,1-3H3/b13-12-,14-4- |
| InChIKey | UKUJBQPNVDUTHM-FKLDUZTJSA-N |
| XLogP | 5.92 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|